C18H18O3 — CID 11780991
(3,5-dimethylbenzoyl) 3,5-dimethylbenzoate (PubChem CID 11780991) has the molecular formula C18H18O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is (3,5-dimethylbenzoyl) 3,5-dimethylbenzoate.
| Compound Name | (3,5-dimethylbenzoyl) 3,5-dimethylbenzoate |
|---|---|
| PubChem CID | 11780991 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | (3,5-dimethylbenzoyl) 3,5-dimethylbenzoate |
| SMILES | Cc1cc(C)cc(C(=O)OC(=O)c2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C18H18O3/c1-11-5-12(2)8-15(7-11)17(19)21-18(20)16-9-13(3)6-14(4)10-16/h5-10H,1-4H3 |
| InChIKey | AOSWHQDEXHYBMJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|