C15H23NO2 — CID 71391256
[2-(dimethylamino)-2-methylpropyl] 3,5-dimethylbenzoate (PubChem CID 71391256) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is [2-(dimethylamino)-2-methylpropyl] 3,5-dimethylbenzoate.
| Compound Name | [2-(dimethylamino)-2-methylpropyl] 3,5-dimethylbenzoate |
|---|---|
| PubChem CID | 71391256 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | [2-(dimethylamino)-2-methylpropyl] 3,5-dimethylbenzoate |
| SMILES | Cc1cc(C)cc(C(=O)OCC(C)(C)N(C)C)c1 |
| InChI | InChI=1S/C15H23NO2/c1-11-7-12(2)9-13(8-11)14(17)18-10-15(3,4)16(5)6/h7-9H,10H2,1-6H3 |
| InChIKey | VFRHIQJZDRTTDI-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |