C24H28O4 — CID 132942251
[2-(3,5-dimethylbenzoyl)oxy-2,3-dimethylbut-3-enyl] 3,5-dimethylbenzoate (PubChem CID 132942251) has the molecular formula C24H28O4 and a molecular weight of 380.48 g/mol. Its IUPAC name is [2-(3,5-dimethylbenzoyl)oxy-2,3-dimethylbut-3-enyl] 3,5-dimethylbenzoate.
| Compound Name | [2-(3,5-dimethylbenzoyl)oxy-2,3-dimethylbut-3-enyl] 3,5-dimethylbenzoate |
|---|---|
| PubChem CID | 132942251 |
| Molecular Formula | C24H28O4 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | [2-(3,5-dimethylbenzoyl)oxy-2,3-dimethylbut-3-enyl] 3,5-dimethylbenzoate |
| SMILES | C=C(C)C(C)(COC(=O)c1cc(C)cc(C)c1)OC(=O)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C24H28O4/c1-15(2)24(7,28-23(26)21-12-18(5)9-19(6)13-21)14-27-22(25)20-10-16(3)8-17(4)11-20/h8-13H,1,14H2,2-7H3 |
| InChIKey | PGIPTUJQXPVQHH-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|