C21H24O6 — CID 173266460
1-(3,5-dimethylbenzoyl)peroxypropyl 3,5-dimethylbenzenecarboperoxoate (PubChem CID 173266460) has the molecular formula C21H24O6 and a molecular weight of 372.42 g/mol. Its IUPAC name is 1-(3,5-dimethylbenzoyl)peroxypropyl 3,5-dimethylbenzenecarboperoxoate.
| Compound Name | 1-(3,5-dimethylbenzoyl)peroxypropyl 3,5-dimethylbenzenecarboperoxoate |
|---|---|
| PubChem CID | 173266460 |
| Molecular Formula | C21H24O6 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 1-(3,5-dimethylbenzoyl)peroxypropyl 3,5-dimethylbenzenecarboperoxoate |
| SMILES | CCC(OOC(=O)c1cc(C)cc(C)c1)OOC(=O)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C21H24O6/c1-6-19(24-26-20(22)17-9-13(2)7-14(3)10-17)25-27-21(23)18-11-15(4)8-16(5)12-18/h7-12,19H,6H2,1-5H3 |
| InChIKey | PPYKLNPUCZFFGC-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|