methyl 3-bromo-5-methylbenzenecarboperoxoate

C9H9BrO3 — CID 166686866

IUPACmethyl 3-bromo-5-methylbenzenecarboperoxoate
SMILESCOOC(=O)c1cc(C)cc(Br)c1
InChIInChI=1S/C9H9BrO3/c1-6-3-7(5-8(10)4-6)9(11)13-12-2/h3-5H,1-2H3
InChIKeyVTVSTVVFWAUDPL-UHFFFAOYSA-N
MW245.07 g/mol
LogP2.48
Rot. Bonds2

About methyl 3-bromo-5-methylbenzenecarboperoxoate

methyl 3-bromo-5-methylbenzenecarboperoxoate (PubChem CID 166686866) has the molecular formula C9H9BrO3 and a molecular weight of 245.07 g/mol. Its IUPAC name is methyl 3-bromo-5-methylbenzenecarboperoxoate.

Molecular Properties

Compound Namemethyl 3-bromo-5-methylbenzenecarboperoxoate
PubChem CID166686866
Molecular FormulaC9H9BrO3
Molecular Weight245.07 g/mol
Exact Mass243.97
IUPAC Namemethyl 3-bromo-5-methylbenzenecarboperoxoate
SMILESCOOC(=O)c1cc(C)cc(Br)c1
InChIInChI=1S/C9H9BrO3/c1-6-3-7(5-8(10)4-6)9(11)13-12-2/h3-5H,1-2H3
InChIKeyVTVSTVVFWAUDPL-UHFFFAOYSA-N
XLogP2.48
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500245.07
LogP ≤ 52.48
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}

Analyze methyl 3-bromo-5-methylbenzenecarboperoxoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-bromo-5-methylbenzenecarboperoxoate?
The IUPAC name of methyl 3-bromo-5-methylbenzenecarboperoxoate (CID 166686866) is methyl 3-bromo-5-methylbenzenecarboperoxoate.
What is the SMILES notation for methyl 3-bromo-5-methylbenzenecarboperoxoate?
The canonical SMILES for methyl 3-bromo-5-methylbenzenecarboperoxoate is COOC(=O)c1cc(C)cc(Br)c1.
What is the InChIKey of methyl 3-bromo-5-methylbenzenecarboperoxoate?
The InChIKey is VTVSTVVFWAUDPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrO3/c1-6-3-7(5-8(10)4-6)9(11)13-12-2/h3-5H,1-2H3.
What are the key properties of methyl 3-bromo-5-methylbenzenecarboperoxoate?
methyl 3-bromo-5-methylbenzenecarboperoxoate has a molecular weight of 245.07 g/mol, XLogP of 2.48, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-bromo-5-methylbenzenecarboperoxoate is sourced from PubChem (CID 166686866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).