About propyl 3-bromo-5-methylbenzoate
propyl 3-bromo-5-methylbenzoate (PubChem CID 115999532) has the molecular formula C11H13BrO2
and a molecular weight of 257.13 g/mol. Its IUPAC name is propyl 3-bromo-5-methylbenzoate.
Molecular Properties
| Compound Name | propyl 3-bromo-5-methylbenzoate |
| PubChem CID | 115999532 |
| Molecular Formula | C11H13BrO2 |
| Molecular Weight | 257.13 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | propyl 3-bromo-5-methylbenzoate |
| SMILES | CCCOC(=O)c1cc(C)cc(Br)c1 |
| InChI | InChI=1S/C11H13BrO2/c1-3-4-14-11(13)9-5-8(2)6-10(12)7-9/h5-7H,3-4H2,1-2H3 |
| InChIKey | XDHCMHXKZIYFCE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.13 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze propyl 3-bromo-5-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 3-bromo-5-methylbenzoate?
The IUPAC name of propyl 3-bromo-5-methylbenzoate (CID 115999532) is propyl 3-bromo-5-methylbenzoate.
What is the SMILES notation for propyl 3-bromo-5-methylbenzoate?
The canonical SMILES for propyl 3-bromo-5-methylbenzoate is CCCOC(=O)c1cc(C)cc(Br)c1.
What is the InChIKey of propyl 3-bromo-5-methylbenzoate?
The InChIKey is XDHCMHXKZIYFCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BrO2/c1-3-4-14-11(13)9-5-8(2)6-10(12)7-9/h5-7H,3-4H2,1-2H3.
What are the key properties of propyl 3-bromo-5-methylbenzoate?
propyl 3-bromo-5-methylbenzoate has a molecular weight of 257.13 g/mol, XLogP of 3.32, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 3-bromo-5-methylbenzoate is sourced from PubChem (CID 115999532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).