C23H28O6 — CID 173266234
1-(3,5-dimethylbenzoyl)peroxypentyl 3,5-dimethylbenzenecarboperoxoate (PubChem CID 173266234) has the molecular formula C23H28O6 and a molecular weight of 400.47 g/mol. Its IUPAC name is 1-(3,5-dimethylbenzoyl)peroxypentyl 3,5-dimethylbenzenecarboperoxoate.
| Compound Name | 1-(3,5-dimethylbenzoyl)peroxypentyl 3,5-dimethylbenzenecarboperoxoate |
|---|---|
| PubChem CID | 173266234 |
| Molecular Formula | C23H28O6 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 1-(3,5-dimethylbenzoyl)peroxypentyl 3,5-dimethylbenzenecarboperoxoate |
| SMILES | CCCCC(OOC(=O)c1cc(C)cc(C)c1)OOC(=O)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C23H28O6/c1-6-7-8-21(26-28-22(24)19-11-15(2)9-16(3)12-19)27-29-23(25)20-13-17(4)10-18(5)14-20/h9-14,21H,6-8H2,1-5H3 |
| InChIKey | VCQTWZKQAZQEEW-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|