C17H18BrNO — CID 22282279
2-bromo-1-(3,5-dimethylphenyl)-2-(2,6-dimethyl-4-pyridinyl)ethanone (PubChem CID 22282279) has the molecular formula C17H18BrNO and a molecular weight of 332.24 g/mol. Its IUPAC name is 2-bromo-1-(3,5-dimethylphenyl)-2-(2,6-dimethyl-4-pyridinyl)ethanone.
| Compound Name | 2-bromo-1-(3,5-dimethylphenyl)-2-(2,6-dimethyl-4-pyridinyl)ethanone |
|---|---|
| PubChem CID | 22282279 |
| Molecular Formula | C17H18BrNO |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 2-bromo-1-(3,5-dimethylphenyl)-2-(2,6-dimethyl-4-pyridinyl)ethanone |
| SMILES | Cc1cc(C)cc(C(=O)C(Br)c2cc(C)nc(C)c2)c1 |
| InChI | InChI=1S/C17H18BrNO/c1-10-5-11(2)7-15(6-10)17(20)16(18)14-8-12(3)19-13(4)9-14/h5-9,16H,1-4H3 |
| InChIKey | VSWJTJYFDWOOFP-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|