C9H7ClF2O — CID 91658558
1-(3-chloro-4-methylphenyl)-2,2-difluoroethanone (PubChem CID 91658558) has the molecular formula C9H7ClF2O and a molecular weight of 204.60 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-2,2-difluoroethanone.
| Compound Name | 1-(3-chloro-4-methylphenyl)-2,2-difluoroethanone |
|---|---|
| PubChem CID | 91658558 |
| Molecular Formula | C9H7ClF2O |
| Molecular Weight | 204.60 g/mol |
| Exact Mass | 204.02 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-2,2-difluoroethanone |
| SMILES | Cc1ccc(C(=O)C(F)F)cc1Cl |
| InChI | InChI=1S/C9H7ClF2O/c1-5-2-3-6(4-7(5)10)8(13)9(11)12/h2-4,9H,1H3 |
| InChIKey | RBHBIBRIIILEED-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.60 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |