C10H9ClO2 — CID 82125872
1-(3-chloro-4-methylphenyl)propane-1,2-dione (PubChem CID 82125872) has the molecular formula C10H9ClO2 and a molecular weight of 196.63 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)propane-1,2-dione.
| Compound Name | 1-(3-chloro-4-methylphenyl)propane-1,2-dione |
|---|---|
| PubChem CID | 82125872 |
| Molecular Formula | C10H9ClO2 |
| Molecular Weight | 196.63 g/mol |
| Exact Mass | 196.03 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)propane-1,2-dione |
| SMILES | CC(=O)C(=O)c1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C10H9ClO2/c1-6-3-4-8(5-9(6)11)10(13)7(2)12/h3-5H,1-2H3 |
| InChIKey | OJCYPRFBRAGQRV-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.63 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|