C8H4F4O — CID 91636131
1-(3,5-difluorophenyl)-2,2-difluoroethanone (PubChem CID 91636131) has the molecular formula C8H4F4O and a molecular weight of 192.11 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)-2,2-difluoroethanone.
| Compound Name | 1-(3,5-difluorophenyl)-2,2-difluoroethanone |
|---|---|
| PubChem CID | 91636131 |
| Molecular Formula | C8H4F4O |
| Molecular Weight | 192.11 g/mol |
| Exact Mass | 192.02 |
| IUPAC Name | 1-(3,5-difluorophenyl)-2,2-difluoroethanone |
| SMILES | O=C(c1cc(F)cc(F)c1)C(F)F |
| InChI | InChI=1S/C8H4F4O/c9-5-1-4(2-6(10)3-5)7(13)8(11)12/h1-3,8H |
| InChIKey | QPYPXOQLPRCLGP-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.11 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |