C12H15F2NO — CID 116574642
2-(aminomethyl)-1-(3,5-difluorophenyl)pentan-1-one (PubChem CID 116574642) has the molecular formula C12H15F2NO and a molecular weight of 227.25 g/mol. Its IUPAC name is 2-(aminomethyl)-1-(3,5-difluorophenyl)pentan-1-one.
| Compound Name | 2-(aminomethyl)-1-(3,5-difluorophenyl)pentan-1-one |
|---|---|
| PubChem CID | 116574642 |
| Molecular Formula | C12H15F2NO |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 2-(aminomethyl)-1-(3,5-difluorophenyl)pentan-1-one |
| SMILES | CCCC(CN)C(=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H15F2NO/c1-2-3-8(7-15)12(16)9-4-10(13)6-11(14)5-9/h4-6,8H,2-3,7,15H2,1H3 |
| InChIKey | IZDMAAQUHGHEBX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |