About CID 70455298
CID 70455298 (PubChem CID 70455298) has the molecular formula C9H10NaO3
and a molecular weight of 189.17 g/mol.
Molecular Properties
| Compound Name | CID 70455298 |
| PubChem CID | 70455298 |
| Molecular Formula | C9H10NaO3 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.05 |
| IUPAC Name | — |
| SMILES | Cc1ccc(C(=O)C(O)O)cc1.[Na] |
| InChI | InChI=1S/C9H10O3.Na/c1-6-2-4-7(5-3-6)8(10)9(11)12;/h2-5,9,11-12H,1H3; |
| InChIKey | NIGGFTCOBASBPN-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 70455298 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 70455298?
The IUPAC name of CID 70455298 (CID 70455298) is not available.
What is the SMILES notation for CID 70455298?
The canonical SMILES for CID 70455298 is Cc1ccc(C(=O)C(O)O)cc1.[Na].
What is the InChIKey of CID 70455298?
The InChIKey is NIGGFTCOBASBPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3.Na/c1-6-2-4-7(5-3-6)8(10)9(11)12;/h2-5,9,11-12H,1H3;.
What are the key properties of CID 70455298?
CID 70455298 has a molecular weight of 189.17 g/mol, XLogP of 0.11, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 70455298 is sourced from PubChem (CID 70455298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).