C14H20O3 — CID 134930916
(2R,3S)-2,3-dihydroxy-1-(4-methylphenyl)heptan-1-one (PubChem CID 134930916) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (2R,3S)-2,3-dihydroxy-1-(4-methylphenyl)heptan-1-one.
| Compound Name | (2R,3S)-2,3-dihydroxy-1-(4-methylphenyl)heptan-1-one |
|---|---|
| PubChem CID | 134930916 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (2R,3S)-2,3-dihydroxy-1-(4-methylphenyl)heptan-1-one |
| SMILES | CCCC[C@H](O)[C@@H](O)C(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H20O3/c1-3-4-5-12(15)14(17)13(16)11-8-6-10(2)7-9-11/h6-9,12,14-15,17H,3-5H2,1-2H3/t12-,14+/m0/s1 |
| InChIKey | QICKYYGNGPWYIU-GXTWGEPZSA-N |
| XLogP | 2.09 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |