C26H30O10 — CID 175293907
diethyl 2,3-dihydroxybutanedioate;2-(4-methylbenzoyl)-3-(4-methylphenyl)-3-oxopropanoic acid (PubChem CID 175293907) has the molecular formula C26H30O10 and a molecular weight of 502.52 g/mol. Its IUPAC name is diethyl 2,3-dihydroxybutanedioate;2-(4-methylbenzoyl)-3-(4-methylphenyl)-3-oxopropanoic acid.
| Compound Name | diethyl 2,3-dihydroxybutanedioate;2-(4-methylbenzoyl)-3-(4-methylphenyl)-3-oxopropanoic acid |
|---|---|
| PubChem CID | 175293907 |
| Molecular Formula | C26H30O10 |
| Molecular Weight | 502.52 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | diethyl 2,3-dihydroxybutanedioate;2-(4-methylbenzoyl)-3-(4-methylphenyl)-3-oxopropanoic acid |
| SMILES | CCOC(=O)C(O)C(O)C(=O)OCC.Cc1ccc(C(=O)C(C(=O)O)C(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C18H16O4.C8H14O6/c1-11-3-7-13(8-4-11)16(19)15(18(21)22)17(20)14-9-5-12(2)6-10-14;1-3-13-7(11)5(9)6(10)8(12)14-4-2/h3-10,15H,1-2H3,(H,21,22);5-6,9-10H,3-4H2,1-2H3 |
| InChIKey | ZYUUCOUWKSUQQO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 164.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.52 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|