C10H10Br2O — CID 130938637
2,3-dibromo-1-(4-methylphenyl)propan-1-one (PubChem CID 130938637) has the molecular formula C10H10Br2O and a molecular weight of 306.00 g/mol. Its IUPAC name is 2,3-dibromo-1-(4-methylphenyl)propan-1-one.
| Compound Name | 2,3-dibromo-1-(4-methylphenyl)propan-1-one |
|---|---|
| PubChem CID | 130938637 |
| Molecular Formula | C10H10Br2O |
| Molecular Weight | 306.00 g/mol |
| Exact Mass | 303.91 |
| IUPAC Name | 2,3-dibromo-1-(4-methylphenyl)propan-1-one |
| SMILES | Cc1ccc(C(=O)C(Br)CBr)cc1 |
| InChI | InChI=1S/C10H10Br2O/c1-7-2-4-8(5-3-7)10(13)9(12)6-11/h2-5,9H,6H2,1H3 |
| InChIKey | PERABOKURNBNKI-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.00 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|