About ethane;2-methylhexan-3-one;2-methyl-1-(4-methylphenyl)propan-1-one
ethane;2-methylhexan-3-one;2-methyl-1-(4-methylphenyl)propan-1-one (PubChem CID 163265020) has the molecular formula C20H34O2
and a molecular weight of 306.49 g/mol. Its IUPAC name is ethane;2-methylhexan-3-one;2-methyl-1-(4-methylphenyl)propan-1-one.
Molecular Properties
| Compound Name | ethane;2-methylhexan-3-one;2-methyl-1-(4-methylphenyl)propan-1-one |
| PubChem CID | 163265020 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | ethane;2-methylhexan-3-one;2-methyl-1-(4-methylphenyl)propan-1-one |
| SMILES | CC.CCCC(=O)C(C)C.Cc1ccc(C(=O)C(C)C)cc1 |
| InChI | InChI=1S/C11H14O.C7H14O.C2H6/c1-8(2)11(12)10-6-4-9(3)5-7-10;1-4-5-7(8)6(2)3;1-2/h4-8H,1-3H3;6H,4-5H2,1-3H3;1-2H3 |
| InChIKey | QFAIRSUOBUIYJF-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;2-methylhexan-3-one;2-methyl-1-(4-methylphenyl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylhexan-3-one;2-methyl-1-(4-methylphenyl)propan-1-one?
The IUPAC name of ethane;2-methylhexan-3-one;2-methyl-1-(4-methylphenyl)propan-1-one (CID 163265020) is ethane;2-methylhexan-3-one;2-methyl-1-(4-methylphenyl)propan-1-one.
What is the SMILES notation for ethane;2-methylhexan-3-one;2-methyl-1-(4-methylphenyl)propan-1-one?
The canonical SMILES for ethane;2-methylhexan-3-one;2-methyl-1-(4-methylphenyl)propan-1-one is CC.CCCC(=O)C(C)C.Cc1ccc(C(=O)C(C)C)cc1.
What is the InChIKey of ethane;2-methylhexan-3-one;2-methyl-1-(4-methylphenyl)propan-1-one?
The InChIKey is QFAIRSUOBUIYJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O.C7H14O.C2H6/c1-8(2)11(12)10-6-4-9(3)5-7-10;1-4-5-7(8)6(2)3;1-2/h4-8H,1-3H3;6H,4-5H2,1-3H3;1-2H3.
What are the key properties of ethane;2-methylhexan-3-one;2-methyl-1-(4-methylphenyl)propan-1-one?
ethane;2-methylhexan-3-one;2-methyl-1-(4-methylphenyl)propan-1-one has a molecular weight of 306.49 g/mol, XLogP of 5.87, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylhexan-3-one;2-methyl-1-(4-methylphenyl)propan-1-one is sourced from PubChem (CID 163265020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).