C11H12F2O — CID 91636257
2,2-difluoro-1-(4-propan-2-ylphenyl)ethanone (PubChem CID 91636257) has the molecular formula C11H12F2O and a molecular weight of 198.21 g/mol. Its IUPAC name is 2,2-difluoro-1-(4-propan-2-ylphenyl)ethanone.
| Compound Name | 2,2-difluoro-1-(4-propan-2-ylphenyl)ethanone |
|---|---|
| PubChem CID | 91636257 |
| Molecular Formula | C11H12F2O |
| Molecular Weight | 198.21 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 2,2-difluoro-1-(4-propan-2-ylphenyl)ethanone |
| SMILES | CC(C)c1ccc(C(=O)C(F)F)cc1 |
| InChI | InChI=1S/C11H12F2O/c1-7(2)8-3-5-9(6-4-8)10(14)11(12)13/h3-7,11H,1-2H3 |
| InChIKey | IHHOEDUJOTUSEH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.21 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |