About lithium 4-propan-2-ylbenzoate
lithium 4-propan-2-ylbenzoate (PubChem CID 58547643) has the molecular formula C10H11LiO2
and a molecular weight of 170.14 g/mol. Its IUPAC name is lithium 4-propan-2-ylbenzoate.
Molecular Properties
| Compound Name | lithium 4-propan-2-ylbenzoate |
| PubChem CID | 58547643 |
| Molecular Formula | C10H11LiO2 |
| Molecular Weight | 170.14 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | lithium 4-propan-2-ylbenzoate |
| SMILES | CC(C)c1ccc(C(=O)[O-])cc1.[Li+] |
| InChI | InChI=1S/C10H12O2.Li/c1-7(2)8-3-5-9(6-4-8)10(11)12;/h3-7H,1-2H3,(H,11,12);/q;+1/p-1 |
| InChIKey | SVCROWDVOWZNDU-UHFFFAOYSA-M |
| XLogP | -1.82 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.14 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze lithium 4-propan-2-ylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 4-propan-2-ylbenzoate?
The IUPAC name of lithium 4-propan-2-ylbenzoate (CID 58547643) is lithium 4-propan-2-ylbenzoate.
What is the SMILES notation for lithium 4-propan-2-ylbenzoate?
The canonical SMILES for lithium 4-propan-2-ylbenzoate is CC(C)c1ccc(C(=O)[O-])cc1.[Li+].
What is the InChIKey of lithium 4-propan-2-ylbenzoate?
The InChIKey is SVCROWDVOWZNDU-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H12O2.Li/c1-7(2)8-3-5-9(6-4-8)10(11)12;/h3-7H,1-2H3,(H,11,12);/q;+1/p-1.
What are the key properties of lithium 4-propan-2-ylbenzoate?
lithium 4-propan-2-ylbenzoate has a molecular weight of 170.14 g/mol, XLogP of -1.82, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 4-propan-2-ylbenzoate is sourced from PubChem (CID 58547643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).