C14H11F9O — CID 146007209
2,2,3,3,4,4,5,5,5-nonafluoro-1-(4-propan-2-ylphenyl)pentan-1-one (PubChem CID 146007209) has the molecular formula C14H11F9O and a molecular weight of 366.22 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,5-nonafluoro-1-(4-propan-2-ylphenyl)pentan-1-one.
| Compound Name | 2,2,3,3,4,4,5,5,5-nonafluoro-1-(4-propan-2-ylphenyl)pentan-1-one |
|---|---|
| PubChem CID | 146007209 |
| Molecular Formula | C14H11F9O |
| Molecular Weight | 366.22 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 2,2,3,3,4,4,5,5,5-nonafluoro-1-(4-propan-2-ylphenyl)pentan-1-one |
| SMILES | CC(C)c1ccc(C(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H11F9O/c1-7(2)8-3-5-9(6-4-8)10(24)11(15,16)12(17,18)13(19,20)14(21,22)23/h3-7H,1-2H3 |
| InChIKey | LVRJUYYAUNSDIG-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.22 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|