C13H3F15O — CID 146008670
1-[3,5-bis(trifluoromethyl)phenyl]-2,2,3,3,4,4,5,5,5-nonafluoropentan-1-one (PubChem CID 146008670) has the molecular formula C13H3F15O and a molecular weight of 460.14 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-2,2,3,3,4,4,5,5,5-nonafluoropentan-1-one.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-2,2,3,3,4,4,5,5,5-nonafluoropentan-1-one |
|---|---|
| PubChem CID | 146008670 |
| Molecular Formula | C13H3F15O |
| Molecular Weight | 460.14 g/mol |
| Exact Mass | 459.99 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-2,2,3,3,4,4,5,5,5-nonafluoropentan-1-one |
| SMILES | O=C(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H3F15O/c14-8(15,11(22,23)12(24,25)13(26,27)28)7(29)4-1-5(9(16,17)18)3-6(2-4)10(19,20)21/h1-3H |
| InChIKey | VPSXOGBQADSRDY-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.14 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|