C12H4F15NO4S2 — CID 167364853
N-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)-3,5-bis(trifluoromethyl)benzenesulfonamide (PubChem CID 167364853) has the molecular formula C12H4F15NO4S2 and a molecular weight of 575.27 g/mol. Its IUPAC name is N-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)-3,5-bis(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)-3,5-bis(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 167364853 |
| Molecular Formula | C12H4F15NO4S2 |
| Molecular Weight | 575.27 g/mol |
| Exact Mass | 574.93 |
| IUPAC Name | N-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)-3,5-bis(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H4F15NO4S2/c13-7(14,15)4-1-5(8(16,17)18)3-6(2-4)33(29,30)28-34(31,32)12(26,27)10(21,22)9(19,20)11(23,24)25/h1-3,28H |
| InChIKey | POXHSELVTJAJHA-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.27 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|