C14H8F7NO2S — CID 51557585
N-(2-fluorophenyl)-3,5-bis(trifluoromethyl)benzenesulfonamide (PubChem CID 51557585) has the molecular formula C14H8F7NO2S and a molecular weight of 387.28 g/mol. Its IUPAC name is N-(2-fluorophenyl)-3,5-bis(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(2-fluorophenyl)-3,5-bis(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 51557585 |
| Molecular Formula | C14H8F7NO2S |
| Molecular Weight | 387.28 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | N-(2-fluorophenyl)-3,5-bis(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccccc1F)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H8F7NO2S/c15-11-3-1-2-4-12(11)22-25(23,24)10-6-8(13(16,17)18)5-9(7-10)14(19,20)21/h1-7,22H |
| InChIKey | XKATVVSHPASASA-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.28 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |