C15H9F6NO3S — CID 46918837
N-(2-formylphenyl)-3,5-bis(trifluoromethyl)benzenesulfonamide (PubChem CID 46918837) has the molecular formula C15H9F6NO3S and a molecular weight of 397.30 g/mol. Its IUPAC name is N-(2-formylphenyl)-3,5-bis(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(2-formylphenyl)-3,5-bis(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 46918837 |
| Molecular Formula | C15H9F6NO3S |
| Molecular Weight | 397.30 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | N-(2-formylphenyl)-3,5-bis(trifluoromethyl)benzenesulfonamide |
| SMILES | O=Cc1ccccc1NS(=O)(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H9F6NO3S/c16-14(17,18)10-5-11(15(19,20)21)7-12(6-10)26(24,25)22-13-4-2-1-3-9(13)8-23/h1-8,22H |
| InChIKey | NRSADJYSVPMZSX-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.30 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|