C15H14N2O4S — CID 175447480
N-[3-[(2-formylphenyl)sulfamoyl]phenyl]acetamide (PubChem CID 175447480) has the molecular formula C15H14N2O4S and a molecular weight of 318.35 g/mol. Its IUPAC name is N-[3-[(2-formylphenyl)sulfamoyl]phenyl]acetamide.
| Compound Name | N-[3-[(2-formylphenyl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 175447480 |
| Molecular Formula | C15H14N2O4S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | N-[3-[(2-formylphenyl)sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(S(=O)(=O)Nc2ccccc2C=O)c1 |
| InChI | InChI=1S/C15H14N2O4S/c1-11(19)16-13-6-4-7-14(9-13)22(20,21)17-15-8-3-2-5-12(15)10-18/h2-10,17H,1H3,(H,16,19) |
| InChIKey | HCTCTTQYRVZACT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|