C14H8F4INO3S — CID 162582675
N-(4-fluoro-3-formyl-2-iodophenyl)-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 162582675) has the molecular formula C14H8F4INO3S and a molecular weight of 473.19 g/mol. Its IUPAC name is N-(4-fluoro-3-formyl-2-iodophenyl)-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(4-fluoro-3-formyl-2-iodophenyl)-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 162582675 |
| Molecular Formula | C14H8F4INO3S |
| Molecular Weight | 473.19 g/mol |
| Exact Mass | 472.92 |
| IUPAC Name | N-(4-fluoro-3-formyl-2-iodophenyl)-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=Cc1c(F)ccc(NS(=O)(=O)c2cccc(C(F)(F)F)c2)c1I |
| InChI | InChI=1S/C14H8F4INO3S/c15-11-4-5-12(13(19)10(11)7-21)20-24(22,23)9-3-1-2-8(6-9)14(16,17)18/h1-7,20H |
| InChIKey | WIKYMSOHYDNMFU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.19 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|