C19H21F4NO2S — CID 170149312
N-[2-fluoro-4-methyl-5-(2-methylbutan-2-yl)phenyl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 170149312) has the molecular formula C19H21F4NO2S and a molecular weight of 403.44 g/mol. Its IUPAC name is N-[2-fluoro-4-methyl-5-(2-methylbutan-2-yl)phenyl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[2-fluoro-4-methyl-5-(2-methylbutan-2-yl)phenyl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 170149312 |
| Molecular Formula | C19H21F4NO2S |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | N-[2-fluoro-4-methyl-5-(2-methylbutan-2-yl)phenyl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | CCC(C)(C)c1cc(NS(=O)(=O)c2cccc(C(F)(F)F)c2)c(F)cc1C |
| InChI | InChI=1S/C19H21F4NO2S/c1-5-18(3,4)15-11-17(16(20)9-12(15)2)24-27(25,26)14-8-6-7-13(10-14)19(21,22)23/h6-11,24H,5H2,1-4H3 |
| InChIKey | MCTNNLXYPGNXLX-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |