C17H16F3NO4S — CID 91962367
N-(6-propyl-1,3-benzodioxol-5-yl)-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 91962367) has the molecular formula C17H16F3NO4S and a molecular weight of 387.38 g/mol. Its IUPAC name is N-(6-propyl-1,3-benzodioxol-5-yl)-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(6-propyl-1,3-benzodioxol-5-yl)-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 91962367 |
| Molecular Formula | C17H16F3NO4S |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | N-(6-propyl-1,3-benzodioxol-5-yl)-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | CCCc1cc2c(cc1NS(=O)(=O)c1cccc(C(F)(F)F)c1)OCO2 |
| InChI | InChI=1S/C17H16F3NO4S/c1-2-4-11-7-15-16(25-10-24-15)9-14(11)21-26(22,23)13-6-3-5-12(8-13)17(18,19)20/h3,5-9,21H,2,4,10H2,1H3 |
| InChIKey | RAMLPSWDSMKHAL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |