C14H8BrF6NO2S — CID 3372952
N-(3-bromophenyl)-3,5-bis(trifluoromethyl)benzenesulfonamide (PubChem CID 3372952) has the molecular formula C14H8BrF6NO2S and a molecular weight of 448.18 g/mol. Its IUPAC name is N-(3-bromophenyl)-3,5-bis(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(3-bromophenyl)-3,5-bis(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 3372952 |
| Molecular Formula | C14H8BrF6NO2S |
| Molecular Weight | 448.18 g/mol |
| Exact Mass | 446.94 |
| IUPAC Name | N-(3-bromophenyl)-3,5-bis(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(Br)c1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H8BrF6NO2S/c15-10-2-1-3-11(7-10)22-25(23,24)12-5-8(13(16,17)18)4-9(6-12)14(19,20)21/h1-7,22H |
| InChIKey | VQZYKAPQRVJLRV-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.18 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |