C21H26F3NO2S — CID 4546210
3,5-ditert-butyl-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide (PubChem CID 4546210) has the molecular formula C21H26F3NO2S and a molecular weight of 413.51 g/mol. Its IUPAC name is 3,5-ditert-butyl-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide.
| Compound Name | 3,5-ditert-butyl-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 4546210 |
| Molecular Formula | C21H26F3NO2S |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 3,5-ditert-butyl-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)cc(S(=O)(=O)Nc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C21H26F3NO2S/c1-19(2,3)15-10-16(20(4,5)6)13-18(12-15)28(26,27)25-17-9-7-8-14(11-17)21(22,23)24/h7-13,25H,1-6H3 |
| InChIKey | ZNCKIVKHBLSMIV-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |