C13H8Cl2F3NO2S — CID 2107587
2,3-dichloro-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide (PubChem CID 2107587) has the molecular formula C13H8Cl2F3NO2S and a molecular weight of 370.18 g/mol. Its IUPAC name is 2,3-dichloro-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide.
| Compound Name | 2,3-dichloro-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 2107587 |
| Molecular Formula | C13H8Cl2F3NO2S |
| Molecular Weight | 370.18 g/mol |
| Exact Mass | 368.96 |
| IUPAC Name | 2,3-dichloro-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(C(F)(F)F)c1)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H8Cl2F3NO2S/c14-10-5-2-6-11(12(10)15)22(20,21)19-9-4-1-3-8(7-9)13(16,17)18/h1-7,19H |
| InChIKey | VLJAPHOLSLZJCF-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.18 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |