C12H11F3N2O2S2 — CID 106057279
2-(aminomethyl)-N-[3-(trifluoromethyl)phenyl]thiophene-3-sulfonamide (PubChem CID 106057279) has the molecular formula C12H11F3N2O2S2 and a molecular weight of 336.36 g/mol. Its IUPAC name is 2-(aminomethyl)-N-[3-(trifluoromethyl)phenyl]thiophene-3-sulfonamide.
| Compound Name | 2-(aminomethyl)-N-[3-(trifluoromethyl)phenyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106057279 |
| Molecular Formula | C12H11F3N2O2S2 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | 2-(aminomethyl)-N-[3-(trifluoromethyl)phenyl]thiophene-3-sulfonamide |
| SMILES | NCc1sccc1S(=O)(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H11F3N2O2S2/c13-12(14,15)8-2-1-3-9(6-8)17-21(18,19)11-4-5-20-10(11)7-16/h1-6,17H,7,16H2 |
| InChIKey | SJXHDTCFTCTRHZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |