C13H9F6NO2S3 — CID 20624333
N-[3,5-bis(trifluoromethyl)phenyl]-2-(sulfanylmethyl)thiophene-3-sulfonamide (PubChem CID 20624333) has the molecular formula C13H9F6NO2S3 and a molecular weight of 421.41 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-2-(sulfanylmethyl)thiophene-3-sulfonamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-2-(sulfanylmethyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 20624333 |
| Molecular Formula | C13H9F6NO2S3 |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 420.97 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-2-(sulfanylmethyl)thiophene-3-sulfonamide |
| SMILES | O=S(=O)(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccsc1CS |
| InChI | InChI=1S/C13H9F6NO2S3/c14-12(15,16)7-3-8(13(17,18)19)5-9(4-7)20-25(21,22)11-1-2-24-10(11)6-23/h1-5,20,23H,6H2 |
| InChIKey | ANEDDOJVPGQJNU-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|