C12H16F3NO2S — CID 118028245
N-[3-tert-butyl-5-(trifluoromethyl)phenyl]methanesulfonamide (PubChem CID 118028245) has the molecular formula C12H16F3NO2S and a molecular weight of 295.33 g/mol. Its IUPAC name is N-[3-tert-butyl-5-(trifluoromethyl)phenyl]methanesulfonamide.
| Compound Name | N-[3-tert-butyl-5-(trifluoromethyl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 118028245 |
| Molecular Formula | C12H16F3NO2S |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | N-[3-tert-butyl-5-(trifluoromethyl)phenyl]methanesulfonamide |
| SMILES | CC(C)(C)c1cc(NS(C)(=O)=O)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H16F3NO2S/c1-11(2,3)8-5-9(12(13,14)15)7-10(6-8)16-19(4,17)18/h5-7,16H,1-4H3 |
| InChIKey | WLIWNIDPKWXOOU-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |