C10H11ClF3NO2S — CID 116700912
N-[3-chloro-5-(trifluoromethyl)phenyl]propane-2-sulfonamide (PubChem CID 116700912) has the molecular formula C10H11ClF3NO2S and a molecular weight of 301.72 g/mol. Its IUPAC name is N-[3-chloro-5-(trifluoromethyl)phenyl]propane-2-sulfonamide.
| Compound Name | N-[3-chloro-5-(trifluoromethyl)phenyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 116700912 |
| Molecular Formula | C10H11ClF3NO2S |
| Molecular Weight | 301.72 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | N-[3-chloro-5-(trifluoromethyl)phenyl]propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)Nc1cc(Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H11ClF3NO2S/c1-6(2)18(16,17)15-9-4-7(10(12,13)14)3-8(11)5-9/h3-6,15H,1-2H3 |
| InChIKey | RHZUZWFGIONUDE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.72 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |