C9H11F3N2O4S2 — CID 2805852
N-[3-(methanesulfonamido)-5-(trifluoromethyl)phenyl]methanesulfonamide (PubChem CID 2805852) has the molecular formula C9H11F3N2O4S2 and a molecular weight of 332.33 g/mol. Its IUPAC name is N-[3-(methanesulfonamido)-5-(trifluoromethyl)phenyl]methanesulfonamide.
| Compound Name | N-[3-(methanesulfonamido)-5-(trifluoromethyl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 2805852 |
| Molecular Formula | C9H11F3N2O4S2 |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | N-[3-(methanesulfonamido)-5-(trifluoromethyl)phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cc(NS(C)(=O)=O)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H11F3N2O4S2/c1-19(15,16)13-7-3-6(9(10,11)12)4-8(5-7)14-20(2,17)18/h3-5,13-14H,1-2H3 |
| InChIKey | KIZBCEOQFOEQPK-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |