C8H12N2O2S — CID 130662680
N-(2,6-dimethyl-4-pyridinyl)methanesulfonamide (PubChem CID 130662680) has the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. Its IUPAC name is N-(2,6-dimethyl-4-pyridinyl)methanesulfonamide.
| Compound Name | N-(2,6-dimethyl-4-pyridinyl)methanesulfonamide |
|---|---|
| PubChem CID | 130662680 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | N-(2,6-dimethyl-4-pyridinyl)methanesulfonamide |
| SMILES | Cc1cc(NS(C)(=O)=O)cc(C)n1 |
| InChI | InChI=1S/C8H12N2O2S/c1-6-4-8(5-7(2)9-6)10-13(3,11)12/h4-5H,1-3H3,(H,9,10) |
| InChIKey | AQZNLKQEKSHXHH-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |