C7H11N3O2S — CID 5157234
N-(4,6-dimethylpyrimidin-2-yl)methanesulfonamide (PubChem CID 5157234) has the molecular formula C7H11N3O2S and a molecular weight of 201.25 g/mol. Its IUPAC name is N-(4,6-dimethylpyrimidin-2-yl)methanesulfonamide.
| Compound Name | N-(4,6-dimethylpyrimidin-2-yl)methanesulfonamide |
|---|---|
| PubChem CID | 5157234 |
| Molecular Formula | C7H11N3O2S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | N-(4,6-dimethylpyrimidin-2-yl)methanesulfonamide |
| SMILES | Cc1cc(C)nc(NS(C)(=O)=O)n1 |
| InChI | InChI=1S/C7H11N3O2S/c1-5-4-6(2)9-7(8-5)10-13(3,11)12/h4H,1-3H3,(H,8,9,10) |
| InChIKey | IAFWOKATFUMIGU-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |