C12H19NO3S — CID 175307812
N-(3,5-dimethyl-4-propoxyphenyl)methanesulfonamide (PubChem CID 175307812) has the molecular formula C12H19NO3S and a molecular weight of 257.35 g/mol. Its IUPAC name is N-(3,5-dimethyl-4-propoxyphenyl)methanesulfonamide.
| Compound Name | N-(3,5-dimethyl-4-propoxyphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 175307812 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | N-(3,5-dimethyl-4-propoxyphenyl)methanesulfonamide |
| SMILES | CCCOc1c(C)cc(NS(C)(=O)=O)cc1C |
| InChI | InChI=1S/C12H19NO3S/c1-5-6-16-12-9(2)7-11(8-10(12)3)13-17(4,14)15/h7-8,13H,5-6H2,1-4H3 |
| InChIKey | HTESPSNFBNQXFH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |