C14H24O2 — CID 90702699
ethane;5-methoxy-1,3-dimethyl-2-propoxybenzene (PubChem CID 90702699) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is ethane;5-methoxy-1,3-dimethyl-2-propoxybenzene.
| Compound Name | ethane;5-methoxy-1,3-dimethyl-2-propoxybenzene |
|---|---|
| PubChem CID | 90702699 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | ethane;5-methoxy-1,3-dimethyl-2-propoxybenzene |
| SMILES | CC.CCCOc1c(C)cc(OC)cc1C |
| InChI | InChI=1S/C12H18O2.C2H6/c1-5-6-14-12-9(2)7-11(13-4)8-10(12)3;1-2/h7-8H,5-6H2,1-4H3;1-2H3 |
| InChIKey | LMPHPXPJWCDYIS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |