C14H24O3 — CID 91115975
ethane;3-(4-methoxy-2,6-dimethylphenoxy)propan-1-ol (PubChem CID 91115975) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is ethane;3-(4-methoxy-2,6-dimethylphenoxy)propan-1-ol.
| Compound Name | ethane;3-(4-methoxy-2,6-dimethylphenoxy)propan-1-ol |
|---|---|
| PubChem CID | 91115975 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | ethane;3-(4-methoxy-2,6-dimethylphenoxy)propan-1-ol |
| SMILES | CC.COc1cc(C)c(OCCCO)c(C)c1 |
| InChI | InChI=1S/C12H18O3.C2H6/c1-9-7-11(14-3)8-10(2)12(9)15-6-4-5-13;1-2/h7-8,13H,4-6H2,1-3H3;1-2H3 |
| InChIKey | CFXJVLHQHNGIJG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|