C16H28NO2+ — CID 2249854
2-hydroxyethyl-[5-(2,4,6-trimethylphenoxy)pentyl]azanium (PubChem CID 2249854) has the molecular formula C16H28NO2+ and a molecular weight of 266.40 g/mol. Its IUPAC name is 2-hydroxyethyl-[5-(2,4,6-trimethylphenoxy)pentyl]azanium.
| Compound Name | 2-hydroxyethyl-[5-(2,4,6-trimethylphenoxy)pentyl]azanium |
|---|---|
| PubChem CID | 2249854 |
| Molecular Formula | C16H28NO2+ |
| Molecular Weight | 266.40 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | 2-hydroxyethyl-[5-(2,4,6-trimethylphenoxy)pentyl]azanium |
| SMILES | Cc1cc(C)c(OCCCCC[NH2+]CCO)c(C)c1 |
| InChI | InChI=1S/C16H27NO2/c1-13-11-14(2)16(15(3)12-13)19-10-6-4-5-7-17-8-9-18/h11-12,17-18H,4-10H2,1-3H3/p+1 |
| InChIKey | SEJLAPHMCNYZHT-UHFFFAOYSA-O |
| XLogP | 1.72 |
| TPSA | 46.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|