C17H30O — CID 143283157
ethane;2-hexoxy-1,3,5-trimethylbenzene (PubChem CID 143283157) has the molecular formula C17H30O and a molecular weight of 250.43 g/mol. Its IUPAC name is ethane;2-hexoxy-1,3,5-trimethylbenzene.
| Compound Name | ethane;2-hexoxy-1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 143283157 |
| Molecular Formula | C17H30O |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.23 |
| IUPAC Name | ethane;2-hexoxy-1,3,5-trimethylbenzene |
| SMILES | CC.CCCCCCOc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C15H24O.C2H6/c1-5-6-7-8-9-16-15-13(3)10-12(2)11-14(15)4;1-2/h10-11H,5-9H2,1-4H3;1-2H3 |
| InChIKey | JHRUVDMPFPXLBO-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|