4-heptoxy-3,5-dimethylbenzenesulfonic acid

C15H24O4S — CID 87685895

IUPAC4-heptoxy-3,5-dimethylbenzenesulfonic acid
SMILESCCCCCCCOc1c(C)cc(S(=O)(=O)O)cc1C
InChIInChI=1S/C15H24O4S/c1-4-5-6-7-8-9-19-15-12(2)10-14(11-13(15)3)20(16,17)18/h10-11H,4-9H2,1-3H3,(H,16,17,18)
InChIKeyPPGFRONTOVXLJS-UHFFFAOYSA-N
MW300.42 g/mol
LogP3.90
Rot. Bonds8

About 4-heptoxy-3,5-dimethylbenzenesulfonic acid

4-heptoxy-3,5-dimethylbenzenesulfonic acid (PubChem CID 87685895) has the molecular formula C15H24O4S and a molecular weight of 300.42 g/mol. Its IUPAC name is 4-heptoxy-3,5-dimethylbenzenesulfonic acid.

Molecular Properties

Compound Name4-heptoxy-3,5-dimethylbenzenesulfonic acid
PubChem CID87685895
Molecular FormulaC15H24O4S
Molecular Weight300.42 g/mol
Exact Mass300.14
IUPAC Name4-heptoxy-3,5-dimethylbenzenesulfonic acid
SMILESCCCCCCCOc1c(C)cc(S(=O)(=O)O)cc1C
InChIInChI=1S/C15H24O4S/c1-4-5-6-7-8-9-19-15-12(2)10-14(11-13(15)3)20(16,17)18/h10-11H,4-9H2,1-3H3,(H,16,17,18)
InChIKeyPPGFRONTOVXLJS-UHFFFAOYSA-N
XLogP3.90
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds8
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500300.42
LogP ≤ 53.90
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 4-heptoxy-3,5-dimethylbenzenesulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-heptoxy-3,5-dimethylbenzenesulfonic acid?
The IUPAC name of 4-heptoxy-3,5-dimethylbenzenesulfonic acid (CID 87685895) is 4-heptoxy-3,5-dimethylbenzenesulfonic acid.
What is the SMILES notation for 4-heptoxy-3,5-dimethylbenzenesulfonic acid?
The canonical SMILES for 4-heptoxy-3,5-dimethylbenzenesulfonic acid is CCCCCCCOc1c(C)cc(S(=O)(=O)O)cc1C.
What is the InChIKey of 4-heptoxy-3,5-dimethylbenzenesulfonic acid?
The InChIKey is PPGFRONTOVXLJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O4S/c1-4-5-6-7-8-9-19-15-12(2)10-14(11-13(15)3)20(16,17)18/h10-11H,4-9H2,1-3H3,(H,16,17,18).
What are the key properties of 4-heptoxy-3,5-dimethylbenzenesulfonic acid?
4-heptoxy-3,5-dimethylbenzenesulfonic acid has a molecular weight of 300.42 g/mol, XLogP of 3.90, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-heptoxy-3,5-dimethylbenzenesulfonic acid is sourced from PubChem (CID 87685895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).