C16H27NO — CID 62597342
N-propyl-4-(2,4,6-trimethylphenoxy)butan-1-amine (PubChem CID 62597342) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is N-propyl-4-(2,4,6-trimethylphenoxy)butan-1-amine.
| Compound Name | N-propyl-4-(2,4,6-trimethylphenoxy)butan-1-amine |
|---|---|
| PubChem CID | 62597342 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | N-propyl-4-(2,4,6-trimethylphenoxy)butan-1-amine |
| SMILES | CCCNCCCCOc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C16H27NO/c1-5-8-17-9-6-7-10-18-16-14(3)11-13(2)12-15(16)4/h11-12,17H,5-10H2,1-4H3 |
| InChIKey | NYRXFMKEHQERNJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|