C17H30ClNO — CID 2866081
N-butyl-4-(2,3,6-trimethylphenoxy)butan-1-amine;hydrochloride (PubChem CID 2866081) has the molecular formula C17H30ClNO and a molecular weight of 299.89 g/mol. Its IUPAC name is N-butyl-4-(2,3,6-trimethylphenoxy)butan-1-amine;hydrochloride.
| Compound Name | N-butyl-4-(2,3,6-trimethylphenoxy)butan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 2866081 |
| Molecular Formula | C17H30ClNO |
| Molecular Weight | 299.89 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | N-butyl-4-(2,3,6-trimethylphenoxy)butan-1-amine;hydrochloride |
| SMILES | CCCCNCCCCOc1c(C)ccc(C)c1C.Cl |
| InChI | InChI=1S/C17H29NO.ClH/c1-5-6-11-18-12-7-8-13-19-17-15(3)10-9-14(2)16(17)4;/h9-10,18H,5-8,11-13H2,1-4H3;1H |
| InChIKey | UWHJJOMAGPWOSR-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.89 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|