About N-butyl-4-(2,3,6-trimethylphenoxy)butan-1-amine;hydrochloride
N-butyl-4-(2,3,6-trimethylphenoxy)butan-1-amine;hydrochloride (PubChem CID 2866081) has the molecular formula C17H30ClNO
and a molecular weight of 299.89 g/mol. Its IUPAC name is N-butyl-4-(2,3,6-trimethylphenoxy)butan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | N-butyl-4-(2,3,6-trimethylphenoxy)butan-1-amine;hydrochloride |
| PubChem CID | 2866081 |
| Molecular Formula | C17H30ClNO |
| Molecular Weight | 299.89 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | N-butyl-4-(2,3,6-trimethylphenoxy)butan-1-amine;hydrochloride |
| SMILES | CCCCNCCCCOc1c(C)ccc(C)c1C.Cl |
| InChI | InChI=1S/C17H29NO.ClH/c1-5-6-11-18-12-7-8-13-19-17-15(3)10-9-14(2)16(17)4;/h9-10,18H,5-8,11-13H2,1-4H3;1H |
| InChIKey | UWHJJOMAGPWOSR-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.89 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-4-(2,3,6-trimethylphenoxy)butan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-4-(2,3,6-trimethylphenoxy)butan-1-amine;hydrochloride?
The IUPAC name of N-butyl-4-(2,3,6-trimethylphenoxy)butan-1-amine;hydrochloride (CID 2866081) is N-butyl-4-(2,3,6-trimethylphenoxy)butan-1-amine;hydrochloride.
What is the SMILES notation for N-butyl-4-(2,3,6-trimethylphenoxy)butan-1-amine;hydrochloride?
The canonical SMILES for N-butyl-4-(2,3,6-trimethylphenoxy)butan-1-amine;hydrochloride is CCCCNCCCCOc1c(C)ccc(C)c1C.Cl.
What is the InChIKey of N-butyl-4-(2,3,6-trimethylphenoxy)butan-1-amine;hydrochloride?
The InChIKey is UWHJJOMAGPWOSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29NO.ClH/c1-5-6-11-18-12-7-8-13-19-17-15(3)10-9-14(2)16(17)4;/h9-10,18H,5-8,11-13H2,1-4H3;1H.
What are the key properties of N-butyl-4-(2,3,6-trimethylphenoxy)butan-1-amine;hydrochloride?
N-butyl-4-(2,3,6-trimethylphenoxy)butan-1-amine;hydrochloride has a molecular weight of 299.89 g/mol, XLogP of 4.58, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-4-(2,3,6-trimethylphenoxy)butan-1-amine;hydrochloride is sourced from PubChem (CID 2866081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).