C10H14O4 — CID 139835517
[4-(hydroxymethoxy)-3,5-dimethylphenoxy]methanol (PubChem CID 139835517) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is [4-(hydroxymethoxy)-3,5-dimethylphenoxy]methanol.
| Compound Name | [4-(hydroxymethoxy)-3,5-dimethylphenoxy]methanol |
|---|---|
| PubChem CID | 139835517 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | [4-(hydroxymethoxy)-3,5-dimethylphenoxy]methanol |
| SMILES | Cc1cc(OCO)cc(C)c1OCO |
| InChI | InChI=1S/C10H14O4/c1-7-3-9(13-5-11)4-8(2)10(7)14-6-12/h3-4,11-12H,5-6H2,1-2H3 |
| InChIKey | VJPYLBUADZYBCW-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|