About 5-methoxy-2-(3-methoxypropoxy)-1,3-dimethylbenzene
5-methoxy-2-(3-methoxypropoxy)-1,3-dimethylbenzene (PubChem CID 22963239) has the molecular formula C13H20O3
and a molecular weight of 224.30 g/mol. Its IUPAC name is 5-methoxy-2-(3-methoxypropoxy)-1,3-dimethylbenzene.
Molecular Properties
| Compound Name | 5-methoxy-2-(3-methoxypropoxy)-1,3-dimethylbenzene |
| PubChem CID | 22963239 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 5-methoxy-2-(3-methoxypropoxy)-1,3-dimethylbenzene |
| SMILES | COCCCOc1c(C)cc(OC)cc1C |
| InChI | InChI=1S/C13H20O3/c1-10-8-12(15-4)9-11(2)13(10)16-7-5-6-14-3/h8-9H,5-7H2,1-4H3 |
| InChIKey | ZBNPKOGQRSAQIH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-2-(3-methoxypropoxy)-1,3-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-2-(3-methoxypropoxy)-1,3-dimethylbenzene?
The IUPAC name of 5-methoxy-2-(3-methoxypropoxy)-1,3-dimethylbenzene (CID 22963239) is 5-methoxy-2-(3-methoxypropoxy)-1,3-dimethylbenzene.
What is the SMILES notation for 5-methoxy-2-(3-methoxypropoxy)-1,3-dimethylbenzene?
The canonical SMILES for 5-methoxy-2-(3-methoxypropoxy)-1,3-dimethylbenzene is COCCCOc1c(C)cc(OC)cc1C.
What is the InChIKey of 5-methoxy-2-(3-methoxypropoxy)-1,3-dimethylbenzene?
The InChIKey is ZBNPKOGQRSAQIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O3/c1-10-8-12(15-4)9-11(2)13(10)16-7-5-6-14-3/h8-9H,5-7H2,1-4H3.
What are the key properties of 5-methoxy-2-(3-methoxypropoxy)-1,3-dimethylbenzene?
5-methoxy-2-(3-methoxypropoxy)-1,3-dimethylbenzene has a molecular weight of 224.30 g/mol, XLogP of 2.73, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-2-(3-methoxypropoxy)-1,3-dimethylbenzene is sourced from PubChem (CID 22963239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).