C14H21BrO2 — CID 107723451
6-(4-bromo-3,5-dimethylphenoxy)hexan-1-ol (PubChem CID 107723451) has the molecular formula C14H21BrO2 and a molecular weight of 301.22 g/mol. Its IUPAC name is 6-(4-bromo-3,5-dimethylphenoxy)hexan-1-ol.
| Compound Name | 6-(4-bromo-3,5-dimethylphenoxy)hexan-1-ol |
|---|---|
| PubChem CID | 107723451 |
| Molecular Formula | C14H21BrO2 |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 6-(4-bromo-3,5-dimethylphenoxy)hexan-1-ol |
| SMILES | Cc1cc(OCCCCCCO)cc(C)c1Br |
| InChI | InChI=1S/C14H21BrO2/c1-11-9-13(10-12(2)14(11)15)17-8-6-4-3-5-7-16/h9-10,16H,3-8H2,1-2H3 |
| InChIKey | DMIRCLVNPLJEBT-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|