C11H14BrClO3S — CID 107727027
3-(4-bromo-3,5-dimethylphenoxy)propane-1-sulfonyl chloride (PubChem CID 107727027) has the molecular formula C11H14BrClO3S and a molecular weight of 341.65 g/mol. Its IUPAC name is 3-(4-bromo-3,5-dimethylphenoxy)propane-1-sulfonyl chloride.
| Compound Name | 3-(4-bromo-3,5-dimethylphenoxy)propane-1-sulfonyl chloride |
|---|---|
| PubChem CID | 107727027 |
| Molecular Formula | C11H14BrClO3S |
| Molecular Weight | 341.65 g/mol |
| Exact Mass | 339.95 |
| IUPAC Name | 3-(4-bromo-3,5-dimethylphenoxy)propane-1-sulfonyl chloride |
| SMILES | Cc1cc(OCCCS(=O)(=O)Cl)cc(C)c1Br |
| InChI | InChI=1S/C11H14BrClO3S/c1-8-6-10(7-9(2)11(8)12)16-4-3-5-17(13,14)15/h6-7H,3-5H2,1-2H3 |
| InChIKey | UMRKKDSHDHCFFJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.65 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|